Aflatoxin B2
Marine
| Trivial name | NULL |
| Catalog Number | CS-T-47471 |
| Alternative Name(s) | (3S,7R)-11-methoxy-6,8,19- trioxape0,13(17)-tetraene-16,18-dione;(3S,7R)-11-methoxy-6,8,19- trioxape0,13(17)-tetraene-16,18-dione |
| Research Area | Aflatoxins B1, B2, G1, G2 as secondary metabolites of fungal species such as Aspergillus flavus or Aspergillus parasiticus growing on a variety of foods (peanuts, nuts, spices, cereals). Aflatoxins are a group of very carcinogenic mycotoxins with hepatotoxic effects. |
| Molecular Formula | C17H14O6 |
| CAS# | 7220-81-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=CC(O[C@]2([H])[C@@]3([H])CCO2)=C3C(O4)=C1C(CCC5=O)=C5C4=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST47471.html |
| Additional Information | NULL |