(+/-)-nerolidol
(+/-)-nerolidol (Peruviol) is a naturally occurring sesquiterpene found in the essential oils of many types of plants and flowers. It has diverse range of pharmacological and biological activities including antioxidant, anti-microbial, anti-biofilm, anti-parasitic, insecticidal, anti-ulcer, skin penetration enhancer, anti-tumor, anti-nociceptive and anti-inflammatory properties.
| Trivial name | Peruviol |
| Catalog Number | S5345 |
| Molecular Formula | C23H23N3O5 |
| CAS# | 7212-44-4 |
| Inchi | InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1 |
| Inchi Key | UCFGDBYHRUNTLO-QHCPKHFHSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=C(C=CC(=C5CN(C)C)O)N=C4C3=C2)O |
| Size | 25ul |
| Supplier Page | http://www.selleckchem.com/products/nerolidol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/nerolidol-chemical-structure-s5345.gif |