5(6)-Carboxyfluorescein
5(6)-Carboxyfluorescein contains a carboxylic acid that can be used to react with primary amines via carbodiimide activation of the carboxylic acid and cell-impermeant 5,6-FAM can also be used as a nonfixable polar tracer to investigate fusion, lysis and gap-junctional communication and to detect changes in cell or liposome volume.
| Trivial name | 5(6)-FAM |
| Catalog Number | CSN18903 |
| Alternative Name(s) | 5(6)-FAM |
| Research Area | / |
| Molecular Formula | C42H24O14 |
| CAS# | 72088-94-9 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC2=C(C3(C4=C(OC5=C3C=CC(O)=C5)C=C(O)C=C4)OC2=O)C=C1)O.O=C(C6=CC(C7(C8=C(OC9=C7C=CC(O)=C9)C=C(O)C=C8)O%10)=C(C=C6)C%10=O)O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/5(6)-carboxyfluorescein.html |
