2′-Deoxyadenosine 5′-di-phos-phate disodium | MedChemExpress (MCE)
2′-Deoxyadenosine 5′-di-phos-phate disodium (dADP disodium) is an inhibitor of bacterial poly(A) polymerase. It can be used to synthesize deoxyadenosine oligonucleotides with Escherichia coli polynucleotide phosphorylase and other enzymes[1].
| Trivial name | 2'-Deoxyadenosine 5'-di-phos-phate disodium |
| Catalog Number | HY-W010854 |
| Alternative Name(s) | dADP disodium |
| Research Area | Others |
| CAS# | 72003-83-9 |
| Purity | ≥98.0% |
| SMILES | O[C@H]1C[C@H](N2C(N=CN=C3N)=C3N=C2)O[C@@H]1COP(OP(O)(O[Na])=O)(O[Na])=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/2-deoxyadenosine-5-di-phos-phate-disodium.html |