DL-Arginine
Arginine is an α-amino acid that is used in the biosynthesis of proteins and plays an important role in cell division, wound healing, removing ammonia from the body, immune function, and the release of hormones.
| Trivial name | N/A |
| Catalog Number | S5549 |
| Molecular Formula | C22H13FN2O5 |
| CAS# | 7200-25-1 |
| SMILES | CN1C=C(C2=CC3=C(C=C21)OCO3)C4=C(C(=O)NC4=O)C5=COC6=C5C=C(C=C6)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dl-arginine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dl-arginine-chemical-structure-s5549.gif |
