4,4-Dichlorodiphenyldichloroethylene
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-10726 |
| Alternative Name(s) | 4,4DDE;p,p-DDE;4,4-DDE;DDT dehydrochloride;1,1-Dichloro-2,2-bis(4-chlorophenyl)ethene; 4,4′-DDE |
| Research Area | 4,4-DDE is a metabolite of DDT (D434195), a synthetic organochlorine insecticide that functions by opening sodium ion channels in the insects neurons, causing them to fire spontaneously which in turn leads to death. 4,4-DDE has shown to h |
| Molecular Formula | C14H8Cl4 |
| CAS# | 72-55-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl/C(Cl)=C(C1=CC=C(Cl)C=C1)C2=CC=C(Cl)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10726.html |
| Additional Information | NULL |