Alizarin
Alizarin strongly inhibits P450 isoform CYP1A1, CYP1A2 and CYP1B1 with IC50 of 6.2/10.0 and 2.7 μM respectively, weakly inhibits CYP2A6 and CYP2E1, and does not inhibit CYP2C19, CYP3A4 and CYP3A5.
| Trivial name | Anthraquinonic |
| Catalog Number | CSN12906 |
| Alternative Name(s) | Anthraquinonic |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C14H8O4 |
| CAS# | 72-48-0 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(C=CC=C2)C(C3=CC=C(O)C(O)=C13)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/alizarin.html |