Mestranol 10mM * 1mL in DMSO
Mestranol is the 3-methyl ether of ethinylestradiol. It was the estrogen used in many of the first oral contraceptives.
| Trivial name | Mestranol 10mM * 1mL in DMSO |
| Catalog Number | A10572-10mM-D |
| Alternative Name(s) | Ethynylestradiol 3-methyl ether; 17a-Ethynyl-1,3,5(10)-estratriene-3,17b-diol 3-methyl ether |
| Molecular Formula | C21H26O2 |
| CAS# | 72-33-3 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mestranol.html |