Sodium Iodide I-123 is a radiodiagnostic agent.
| Catalog Number | API0232254 |
| Alternative Name(s) | SODIUM LACTATE; 72-17-3; Lactic acid sodium salt |
| Research Area | API |
| Molecular Formula | C3H5NaO3 |
| CAS# | 72-17-3 |
| Inchi | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| Inchi Key | NGSFWBMYFKHRBD-UHFFFAOYSA-M |
| SMILES | CC(C(=O)[O-])O.[Na+] |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/sodium-lactate-item-754.html |
Sodium lactate is an organic sodium salt having lactate as the counterion. It has a role as a food preservative and a food acidity regulator. It is an organic sodium salt and a lactate salt. It contains a lactate.
| Catalog Number | CHE72173 |
| Alternative Name(s) | compound sodium lactate solution SODIUM LACTATE Sodium DL-lactate Lactic acid sodium salt |
| Research Area | Chemicals |
| Molecular Formula | C3H5NaO3 |
| CAS# | 72-17-3 |
| SMILES | CC(C(=O)[O-])O.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/sodium-lactate-item-8981.html |
