(6S)-Tetrahydrofolic acid | MedChemExpress (MCE)
(6S)-Tetrahydrofolic acid is 1000-fold more active than the (6R) form at promoting the binding of fluorodeoxyuridylate to thymidylate synthase and 600-fold more active as a growth factor of P. cerevisiae. (6S)-Tetrahydrofolic acid also has a low affinity and high dissociation rate for folate-binding protein[1].
| Trivial name | (6S)-Tetrahydrofolic acid |
| Catalog Number | HY-14520A |
| Alternative Name(s) | (6S)-5,6,7,8-Tetrahydrofolic acid; (6S)-Tetrahydrofolic acid |
| Research Area | Metabolic Disease |
| CAS# | 71963-69-4 |
| Purity | ≥98.0% |
| SMILES | O=C1C2=C(NC(N)=N1)NC[C@@H](N2)CNC3=CC=C(C=C3)C(N[C@H](C(O)=O)CCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6s-tetrahydrofolic-acid.html |