Dihydroartemisinin 10mM * 1mL in DMSO
Dihydroartemisinin is the active metabolite of all artemisinin compounds (artemisinin, artesunate, artemether, etc.) and is also available as a drug in itself. It is a semi-synthetic derivative of artemisinin and is widely used as an intermediate in the preparation of other artemisinin-derived antimalarial drugs.
| Trivial name | Dihydroartemisinin 10mM * 1mL in DMSO |
| Catalog Number | A10310-10mM-D |
| Alternative Name(s) | (3R,5aS,6R,8aS,9R,10S,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-ol |
| Molecular Formula | C15H24O5 |
| CAS# | 71939-50-9 |
| SMILES | [H][C@@]1(C([H])([H])C2([H])[H])[C@]3([C@@]([C@@]4([H])C([H])([H])[H])([H])C([H])([H])C([H])([H])[C@@]1([H])C([H])([H])[H])OO[C@@]2(C([H])([H])[H])O[C@@]3([H])O[C@@]4([H])O[H] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dihydroartemisinin-dha.html |