Z-Phe-Ala-diazomethylketone | MedChemExpress (MCE)
Z-Phe-Ala-diazomethylketone binds directly to Aβ42 monomers and small oligomers. Z-Phe-Ala-diazomethylketone inhibits the formation of Aβ42 dodecamers and inhibits Aβ42 fibril formation in the solution. Z-Phe-Ala-diazomethylketone has the potential for neurodegenerative disorders research[1].
| Trivial name | Z-Phe-Ala-diazomethylketone |
| Catalog Number | HY-P4295 |
| Alternative Name(s) | PADK |
| Research Area | Neurological Disease |
| CAS# | 71732-53-1 |
| Purity | ≥98.00% |
| SMILES | [N-]=[N+]=CC([C@H](C)NC([C@@H](NC(OCC1=CC=CC=C1)=O)CC2=CC=CC=C2)=O)=O |
| PubChem Chemical Structure ID | 155664 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-phe-ala-diazomethylketone.html |