AC480 (BMS-599626)
AC480 (BMS-599626) is a selective and efficacious inhibitor of HER1 and HER2 with IC50 of 20 nM and 30 nM, ~8-fold less potent to HER4, >100-fold to VEGFR2, c-Kit, Lck, MET etc. Phase 1.
| Trivial name | N/A |
| Catalog Number | S1056 |
| Molecular Formula | C6H6N4O2 |
| CAS# | 714971-09-2 |
| SMILES | CN1C(=O)NC(=O)C2=C1N=C[NH]2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/BMS-599626.html |
| Additional Information | https://file.selleck.cn/downloads/struct/bms-599626-ac480-chemical-structure-s1056.gif |