TTNPB
TTNPB is an agonist of RAR and can inhibit binding of [3H]tRA with RARα (IC50 = 5.1 nM), RARβ (IC50 = 4.5 nM), and RARγ (IC50 = 9.3 nM).
| Trivial name | Ro-13-7410; AGN 191183; Arotinoid Acid |
| Catalog Number | CSN16014 |
| Alternative Name(s) | Ro-13-7410; AGN 191183; Arotinoid Acid |
| Research Area | Cancer |
| Molecular Formula | C24H28O2 |
| CAS# | 71441-28-6 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=CC=C(/C=C(C2=CC=C3C(C)(C)CCC(C)(C)C3=C2)\C)C=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ttnpb.html |
