Meloxicam
Meloxicam is a nonsteroidal anti-inflammatory agent with selectivity for COX2 (IC50 = 11.8 μM) over COX1 (IC50 = 143 μM) in in vitro assays. It shows potent anti-inflammatory, antipyretic, and analgesic effects with low gastrointestinal toxicity.
| Trivial name | UH-AC 62XX |
| Catalog Number | CSN12893 |
| Alternative Name(s) | UH-AC 62XX |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C14H13N3O4S2 |
| CAS# | 71125-38-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(O)C2=CC=CC=C2S(N1C)(=O)=O)NC3=NC=C(C)S3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/meloxicam.html |