Meloxicam
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11686 |
| Alternative Name(s) | 4-Hydroxy-2-methyl-N-(5-methyl-2-thiazolyl)-2H-1,2-benzothiazineDioxide |
| Research Area | Preferential cyclooxygenase (COX-2) inhibitor. Sudoxicam and Meloxicam are nonsteroidal anti-inflammatory drugs (NSAIDs) from the enol-carboxamide class. |
| Molecular Formula | C14H13N3O4S2 |
| CAS# | 71125-38-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC=CC=C1[S]2(=O)=O)=C(N2C)C(NC3=NC=C(C)S3)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11686.html |
| Additional Information | NULL |