β-Zearalenol (Standard) | MedChemExpress (MCE)
β-Zearalenol (Standard) is the analytical standard of β-Zearalenol. This product is intended for research and analytical applications. β-Zearalenol is a non-steroidal estrogenic mycotoxin synthesized by Fusarium species. β-Zearalenol potentially influences transcription and effects gene expression on translational level[1].
| Trivial name | β-Zearalenol (Standard) |
| Catalog Number | HY-N6741R |
| Research Area | Infection; Endocrinology |
| CAS# | 71030-11-0 |
| Purity | ≥98.00% |
| SMILES | OC1=C2C(O[C@H](CCC[C@H](CCC/C=C/C2=CC(O)=C1)O)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/β-zearalenol-standard.html |