Medroxyprogesterone acetate
Steroidal progestin Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | B1510-5.1 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C24H34O4 |
| CAS# | 71-58-9 |
| Purity | 99.74% |
| SMILES | CC1CC2C(CCC3(C2CCC3(C(=O)C)OC(=O)C)C)C4(C1=CC(=O)CC4)C |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1510 |
