Comanthoside A
Comanthoside A is a naturally occurring flavonoid glycoside isolated from Comanthosphace japonica.Comanthoside A is also a key intermediate in the synthesis of Linaroside and Comanthoside B. Comanthoside A is a natural flavonoid glycoside isolated from Comanthosphace japonica.
| Catalog Number | TN3689 |
| Alternative Name(s) | Comanthosid A |
| Research Area | Others |
| Molecular Formula | C24H24O12 |
| CAS# | 70938-59-9 |
| Purity | 99.43% |
| SMILES | OC1=C2C(=CC(O[C@@H]3O[C@H](C(OC)=O)[C@@H](O)[C@H](O)[C@H]3O)=C1OC)OC(=CC2=O)C4=CC=C(OC)C=C4 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/Comanthoside A |
| Additional Information | https://www.targetmol.com/datasheet/TN3689 |