Kuromanine
Kuromanin, a natural product isolated and purified from the herbs of Chrysanthemum indicum, has been shown to improve blood glucose concentrations and lipid homeostasis and to reduce obesity.
| Trivial name | Chrysontemin |
| Catalog Number | CSN11257 |
| Alternative Name(s) | Chrysontemin |
| Research Area | Metabolic Disease |
| Molecular Formula | C21H21ClO11 |
| CAS# | 7084-24-4 |
| Purity | ≥98% |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](OC2=C(C3=CC=C(O)C(O)=C3)[O+]=C4C=C(O)C=C(O)C4=C2)O1.[Cl-] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kuromanine.html |