Doxapram HCl H2O
Doxapram HCl, a respiratory stimulant, exhibits inhibition of TASK-1 (EC50 = 410 nM), TASK-3 (EC50 = 37 nM) and TASK-1/TASK-3 heterodimeric (EC50 = 9 nM) channel function. It is widely used in central nervous system excitability and directly stimulate the medullary respiratory or vascular movement center.
| Trivial name | / |
| Catalog Number | CSN16013 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C24H33ClN2O3 |
| CAS# | 7081-53-0 |
| Purity | ≥99% |
| SMILES | O=C1N(CC)CC(CCN2CCOCC2)C1(C3=CC=CC=C3)C4=CC=CC=C4.[H]Cl.[H]O[H] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/doxapram-hcl-h2o.html |