Cloxacillin Sodium Monohydrate
Cloxacillin Sodium Monohydrate is a semisynthetic penicillin-like antibiotic used to treat infections of the skin, bone, heart valve, blood, and lung.
| Trivial name | Cloxacillin Sodium |
| Catalog Number | CSN10684 |
| Alternative Name(s) | Cloxacillin Sodium |
| Research Area | Infection |
| Molecular Formula | C19H19ClN3NaO6S |
| CAS# | 7081-44-9 |
| Purity | ≥99% |
| SMILES | O=C([C@@H](C(C)(C)S[C@]1([H])[C@@H]2NC(C3=C(C)ON=C3C4=CC=CC=C4Cl)=O)N1C2=O)[O-].[H]O[H].[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cloxacillin-sodium-monohydrate.html |
