Cloxacillin Sodium
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-06255 |
| Alternative Name(s) | (2S,5R,6R)-6-[[[3-3,3-dimethyl-7-oxo-4-thia-1-azabcclo[3.2.0]heptane-2carboxylc cid Sodium Salt; Ankerbin; 3-(ochlorophenyl)-5-methyl-4-isoxazolylpencillin Sodium Salt; Cloxacillin Sodium Monohydrate |
| Research Area | Cloxacillin is an antibiotic that belongs to the group of the isoxazolylpenicillins. Cloxacillin is used to treat infections caused by species of staphylococci that produce beta-lactamase due to its inhibitory effects on beta-lactamase binding. |
| Molecular Formula | C19H1ClN3NaO5S |
| CAS# | 7081-44-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C(C=CC=C1)=C1Cl)=NO2)=C2C)N[C@H]3[C@](SC(C)(C)[C@@H]4C([O-])=O)([H])N4C3=O.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06255.html |
| Additional Information | NULL |