Cloxacillin sodium 10mM * 1mL in DMSO
Cloxacillin is a semisynthetic antibiotic in the same class as penicillin. Cloxacillin is used against staphylococci that produce beta-lactamase, due to its large R chain, which does not allow the beta-lactamases to bind.
| Trivial name | Cloxacillin sodium 10mM * 1mL in DMSO |
| Catalog Number | A10235-10mM-D |
| Alternative Name(s) | Sodium 6-[3-(2-chlorophenyl)-5-methyl-oxazol-4-yl]carbonylamino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate hydra |
| Molecular Formula | C19H19ClN3NaO6S |
| CAS# | 7081-44-9 |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-].O.[Na+] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cloxacillin-sodium.html |
