ARP 100
ARP 100 (MMP-2 Inhibitor III, Compound 10a) is a potent and selective inhibitor of MMP-2 with an IC50 of 12 nM and displays less inhibitory activity at MMP-9, MMP-3, MMP-1 and MMP-7 with IC50s of 200 nM, 4500 nM, >50,000 nM and >50,000 nM respectively.
| Trivial name | MMP-2 Inhibitor III, Compound 10a |
| Catalog Number | S9909 |
| Molecular Formula | C17H20N2O5S |
| CAS# | 704888-90-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)ON(CC(=O)NO)[S](=O)(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/arp-100.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9909-arp-100-chemical-structure.gif |