L-Cysteine (hydrochloride hydrate)
L-Cysteine hydrochloride hydrate is an essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione, and taurine. L-Cysteine hydrochloride hydrate suppresses ghrelin and reduces appetite in rodents and humans.
| Catalog Number | E4218 |
| Molecular Formula | C14H10BrNOS |
| CAS# | 7048-04-6 |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCC3=CC=C(C=C3)Br |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/l-cysteine-hydrochloride-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e4218-L-Cysteine-hydrochloride-hydrate-chemical-structure.png |
