Maysin | MedChemExpress (MCE)
Maysin, a neuroprotective C-glycosyl-flavone, can be isolated from corn silk. Maysinshows protective activity against the damage caused by Syn amyloid aggregates-oligomers and fibrils. Maysinprevents oxidative stress and imbalance of intracellular calcium homeostasis, activating an autophagic degradative process. Maysincan be used for research of Parkinson’s disease (PD)[1].
| Trivial name | Maysin |
| Catalog Number | HY-126636 |
| Research Area | Endocrinology |
| CAS# | 70255-49-1 |
| Purity | ≥98.00% |
| SMILES | O=C1C=C(OC2=C1C(O)=C(C(O)=C2)[C@H](O[C@@H](C3=O)C)[C@@H]([C@H]3O)O[C@]4([H])O[C@H]([C@@H]([C@H]([C@H]4O)O)O)C)C5=CC=C(C(O)=C5)O |
| PubChem Chemical Structure ID | 23843922 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/maysin.html |