BMS 626529 25mg
BMS-626529 is a potent HIV-1 attachment inhibitor. BMS-663068 is also the phosphonooxymethyl prodrug of BMS-626529 that targets HIV-1 gp120 and prevents its binding to CD4(+) T cells.
| Trivial name | BMS 626529 25mg |
| Catalog Number | A14148-25 |
| Alternative Name(s) | 1-(4-benzoylpiperazin-1-yl)-2-(4-methoxy-7-(3-methyl-1H-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
| Molecular Formula | C24H23N7O4 |
| CAS# | 701213-36-7 |
| SMILES | CC1=NN(C=N1)C2=NC=C(C3=C2NC=C3C(=O)C(=O)N4CCN(CC4)C(=O)C5=CC=CC=C5)OC |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/bms-626529.html |
