ABT-724
ABT-724 is a potent and highly selective dopamine D4 receptor agonist with EC50s of 12.4 nM, 14.3 nM and 23.2 nM for human dopamine D4 receptor, rat D4 receptor and ferret D4 receptor.
| Trivial name | / |
| Catalog Number | CSN25294 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C17H19N5 |
| CAS# | 70006-24-5 |
| Purity | ≥98% |
| SMILES | N4(=C(N3(CCN(CC1(=NC2(=CC=CC=C2(N1))))CC3))C=CC=C4) |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/abt-724.html |