Gliclazide EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-44602 |
| Alternative Name(s) | Gliclazide EP Impurity A; 4-Tolylsulfonamide;4-Methylbenzenesulfonamide; 4-Tolylsulfonamide |
| Research Area | 4-Tolylsulfonamide is a carbonic anhydrase inhibitor used the synthesis of antiglaucoma and anticancer drugs. |
| Molecular Formula | C7H9NO2S |
| CAS# | 70-55-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[S](=O)(C1=CC=C(C)C=C1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST44602.html |
| Additional Information | NULL |