NSC-60339
NSC-60339 is an inhibitor of efflux pump and a substrate of AcrAB-TolC. It is a polybasic terephthalic acid derivative that has been studied as a potential cancer chemotherapeutic agent.
| Trivial name | / |
| Catalog Number | CSN27235 |
| Alternative Name(s) | / |
| Research Area | Membrane Transporter |
| Molecular Formula | C26H23ClN6O2 |
| CAS# | 70-09-7 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=C(C(NC2=CC=C(C3=NCCN3)C=C2)=O)C=C1Cl)NC4=CC=C(C5=NCCN5)C=C4 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/2-chloro-n1,n4-bis(4-(4,5-dihydro-1h-imidazol-2-yl)phenyl)terephthalamide.html |