Trifluorothymidine
Trifluorothymidine is a derivative of thymidine that can inhibit thymidylate synthase and lead to DNA damage and apoptosis. It could be used to treat colorectal cancer.
| Trivial name | NSC 529182; NSC-75520; Trifluridine; FTD |
| Catalog Number | CSN10505 |
| Alternative Name(s) | NSC 529182; NSC-75520; Trifluridine; FTD |
| Research Area | Cancer |
| Molecular Formula | C10H11F3N2O5 |
| CAS# | 70-00-8 |
| Purity | ≥99% |
| SMILES | O=C1NC(C(C(F)(F)F)=CN1[C@@H]2O[C@H](CO)[C@@H](O)C2)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/trifluorothymidine.html |