Rifamycin
API Standard
| Catalog Number | CS-O-02237 |
| Alternative Name(s) | (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27,29-Pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(28),2,4,9, |
| Research Area | Rifamycin is a natural antibiotic produced by Streptomyces mediterranei, Rifamycin (Ansamycin Family) is a commonly used antimycobacterial drug that inhibits prokaryotic DNA-dependent RNA synthesis and protein synthesis; it blocks RNA-polymerase transcrip |
| Molecular Formula | C37H47NO12 |
| CAS# | 6998-60-3 |
| Purity | >98% |
| SMILES | O=C1C2=C(C(O)=CC(NC(/C(C)=CC=C[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@H]3C)=O)=C4O)C4=C(O)C(C)=C2O[C@@]1(O/C=C/[C@@H]([C@H]([C@@]3([H])OC(C)=O)C)OC)C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02237.html |
