γ-Costic acid | MedChemExpress (MCE)
γ-Costic acid (compound 13）is a kind of terpenoid. γ-Costic acid can be obtained by chemical transformation. γ-Costic acid has effective antifeedant and cytotoxic doses with EC50 0.5 μg/ml against L. decemlineata[1].
| Trivial name | γ-Costic acid |
| Catalog Number | HY-N3494 |
| Alternative Name(s) | Isocostic acid |
| Research Area | Others |
| CAS# | 69978-82-1 |
| Purity | ≥98.00% |
| SMILES | C[C@]12C(C[C@H](C(C(O)=O)=C)CC1)=C(CCC2)C |
| PubChem Chemical Structure ID | 10922464 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/γ-costic-acid.html |