Atractylone
Atractylone, a natural product isolated and purified from the roots of Atractylodes macrocephala, has inhibitory effects on mast cell-mediated allergic reactions, it regulates the degranulation of mast cell, proves its potential in the treatment of mast cell-mediated allergic reactions.
| Trivial name | / |
| Catalog Number | CSN13607 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C15H20O |
| CAS# | 6989-21-5 |
| Purity | ≥98% |
| SMILES | C=C1[C@]2([H])CC3=C(C[C@@]2(C)CCC1)OC=C3C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/atractylone.html |