UAMC 00039 dihydrochloride
dipeptidyl peptidase II (DPP-II) inhibitor Proteases|Other Proteases
| Catalog Number | B5780-10 |
| Research Area | Proteases|Other Proteases |
| Molecular Formula | C16H24ClN3O.2HCl |
| CAS# | 697797-51-6 |
| Purity | 98.5% |
| SMILES | ClC1=CC=C(C=C1)CNCC[C@@H](C(N2CCCCC2)=O)N.Cl.Cl |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5780 |
