Elvitegravir (GS-9137) 10mM * 1mL in DMSO
Elvitegravir (GS-9137) is a potent inhibitor of the strand-transfer step of integration mediated by human immunodeficiency virus type 1 (HIV-1) integrase.
| Trivial name | Elvitegravir (GS-9137) 10mM * 1mL in DMSO |
| Catalog Number | A10347-10mM-D |
| Alternative Name(s) | 6-[(3-Chloro-2-fluorophenyl)methyl]-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-7-methoxy-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C23H23ClFNO5 |
| CAS# | 697761-98-1 |
| SMILES | CC(C)[C@@H](CO)N1C=C(C(=O)C2=CC(=C(C=C21)OC)CC3=C(C(=CC=C3)Cl)F)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/elvitegravir-gs-9137.html |