tert-Butyldimethylsilyl Trifluoromethanesulfonate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-10906 |
| Alternative Name(s) | (1,1-Dimethylethyl)dimethylsilyl Trifluoromethanesulfonate;TBDMS triflate, Trifluoromethanesulfonic acid tert-butyldimethylsilylester;tert-butyldimethylsilyl trifluoromethanesulfonate |
| Research Area | tert-Butyldimethylsilyl trifluoromethanesulfonate is a highly reactive silylating agent and lewis acid capable of converting primary, secondary and tertiary alcohols to their respectctive TBDMS. tert-Butyldimethylsilyl trifluoromethanesulfonate is also used to covert ketones and lactones into their enol silyl ethers. |
| Molecular Formula | CF3SO3Si(CH3)2C(CH3)3 |
| CAS# | 69739-34-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](O[Si](C)(C)C(C)(C)C)(C(F)(F)F)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10906.html |
| Additional Information | NULL |