Tanshinone IIA Sulfonate Sodium
Tanshinone IIA sulfonate sodium is a water-soluble derivative of tanshinone IIA, which acts as an inhibitor of store-operated Ca2+entry (SOCE), and is used to treat cardiovascular disorders.
| Trivial name | / |
| Catalog Number | CSN13608 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C19H17NaO6S |
| CAS# | 69659-80-9 |
| Purity | ≥98% |
| SMILES | O=S(C1=C(C)C(C(C(C2=C3C=CC4=C2CCCC4(C)C)=O)=O)=C3O1)([O-])=O.[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/tanshinone-iia-sulfonate-sodium.html |