2′, 3′-Dideoxyinosine
An antiviral drug, it is used as a medication to treat HIV/AIDS. It has a role as an antimetabolite, a HIV-1 reverse transcriptase inhibitor, an antiviral drug, an EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor and a geroprotector.
| Catalog Number | PIPB-0458 |
| Alternative Name(s) | didanosine DIDEOXYINOSINE Videx |
| Research Area | 2' 3'-Dideoxy Nucleosides |
| Molecular Formula | C10H12N4O3 |
| CAS# | 69655-05-6 |
| SMILES | C1CC(OC1CO)N2C=NC3=C2N=CNC3=O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/2-3-dideoxyinosine-item-10576.html |