SB-505124 100mg
SB-505124 is a selective inhibitor of transforming growth factor-?? type I receptor (ALK5), ALK4 and ALK7 (IC50 values are 47 and 129 nM for ALK5 and ALK4 respectively).
| Trivial name | SB-505124 100mg |
| Catalog Number | A11157-100 |
| Alternative Name(s) | 2-[4-(1,3-Benzodioxol-5-yl)-2-(1,1- dimethylethyl)-1H-imidazol-5-yl]-6-methyl-pyridine |
| Molecular Formula | C20H21N3O2 |
| CAS# | 694433-59-5 |
| SMILES | CC1=CC=CC(=N1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=C(C=C3)OCO4 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/sb-505124.html |
