Lappaol F | MedChemExpress (MCE)
Lappaol F, a lignin, is an anticancer agent. Lappaol F inhibits YAP<、b> mRNA and protein level. Lappaol F inhibits tumor cell growth by inducing cell cycle arrest. Lappaol F induces cancer cell apoptosis, and inhibits tumor growth. Lappaol F can be isolated from Arctium lappa Linne (Asteraceae)[1].
| Trivial name | Lappaol F |
| Catalog Number | HY-N7223 |
| Research Area | Cancer |
| CAS# | 69394-17-8 |
| Purity | ≥98.00% |
| SMILES | O=C1OC[C@H](CC2=CC(OC)=C(O[C@H](C3=CC=C(O)C(OC)=C3)[C@H]4CO)C4=C2)[C@H]1CC5=CC(OC)=C(O[C@H](C6=CC=C(O)C(OC)=C6)[C@H]7CO)C7=C5 |
| PubChem Chemical Structure ID | 73425459 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lappaol-f.html |