DNP-INT | MedChemExpress (MCE)
DNP-INT is a potent photosynthetic electron transport chain (PETC) inhibitor. DNP-INT competently inhibits the oxidation of plastid quinoline by binding to the Q0 site of Cyt-b6f (Kd=1.4 nM), thereby inhibiting electron transfer in plants[1].
| Trivial name | DNP-INT |
| Catalog Number | HY-119984 |
| Research Area | Others |
| CAS# | 69311-70-2 |
| Purity | ≥98.0% |
| SMILES | CC1=C(C(OC2=CC=C(C=C2[N+]([O-])=O)[N+]([O-])=O)=C(C=C1[N+]([O-])=O)C(C)C)I |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dnp-int.html |