Brivudine
API Standard
| Catalog Number | CS-O-00974 |
| Alternative Name(s) | 5-(2-bromovinyl)-1-(4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Research Area | Brivudine is a uridine derivative and nucleoside analog with pro-apoptotic and chemosensitizing properties. In vitro, bromovinyl-deoxyuridine (BVDU) has been shown to downregulate the multifunctional DNA repair enzyme APEX nuclease 1, resulting in the inh |
| Molecular Formula | C11H13BrN2O5 |
| CAS# | 69304-47-8 |
| Purity | >98% |
| SMILES | O=C(N1)N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=C(/C=C/Br)C1=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00974.html |