1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-17790 |
| Alternative Name(s) | 1,3-dichloro-1,1,3,3-tetraisopropyldisiloxane |
| Research Area | 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane is used in the analysis of Watson-Crick and Hoogstein base pairing in nucleotides. Also used in the formation of ribavirin chemical delivery systems. |
| Molecular Formula | C12H28Cl2OSi2 |
| CAS# | 69304-37-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[Si](C(C)C)(C(C)C)O[Si](C(C)C)(Cl)C(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST17790.html |
| Additional Information | NULL |