(+)-Leucocyanidin | MedChemExpress (MCE)
(+)-Leucocyanidin is the isoform of Leucocyanidin (HY-119580), is an active anti-ulcerogenic ingredient was extracted from Litchi Chinensis. Leucocyanidin demonstrates a significant protective effect against Aspirin-induced erosions in rat models[1].
| Trivial name | (+)-Leucocyanidin |
| Catalog Number | HY-119580B |
| Alternative Name(s) | 2,3-trans-3,4-trans-Leucocyanidin; 3,4-trans-Leucocyanidin; (2R,3S,4R)-Leucocyanidin |
| Research Area | Inflammation/Immunology |
| CAS# | 69256-15-1 |
| Purity | ≥98.00% |
| SMILES | O[C@@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C3[C@H]1O |
| PubChem Chemical Structure ID | 155206 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-leucocyanidin.html |