(±)-Hexanoylcarnitine chloride
(±)-Hexanoylcarnitine chloride is a fatty acid metabolite that breaks down fatty acids into small compounds that can be utilized by the body. (±)-Hexanoylcarnitine chloride can be used as a biomarker by being specific for rat skeletal muscle toxicity.

Catalog Number | T21841 |
Alternative Name(s) | DL-Hexanoylcarnitine chloride |
Research Area | Others |
Molecular Formula | C13H26ClNO4 |
CAS# | 6920-35-0 |
SMILES | [Cl-].O=C(O)CC(OC(=O)CCCCC)C[N+](C)(C)C |
Size | 5 mg |
Supplier Page | https://www.targetmol.com/compound/_hexanoylcarnitine_chloride |
Additional Information | https://www.targetmol.com/datasheet/T21841 |