Nedocromil Sodium
Nedocromil Sodium is a potent TNF-α inhibitor with an IC50 value of 1.67 μM for Blood eosinophils.
| Trivial name | FPL 59002KP; Nedocromil disodium salt |
| Catalog Number | CSN22471 |
| Alternative Name(s) | FPL 59002KP; Nedocromil disodium salt |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C19H15NNa2O7 |
| CAS# | 69049-74-7 |
| Purity | ≥97% |
| SMILES | O=C1C2=C(C(CCC)=C(C3=C2)OC(C([O-])=O)=CC3=O)N(C(C([O-])=O)=C1)CC.[Na+].[Na+] |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/nedocromil-sodium.html |