ZM 306416 hydrochloride 10mM * 1mL in DMSO
ZM 306416 is a VEGF receptor tyrosine kinase inhibitor that inhibits KDR (IC50 = 100 nM) and Flt (IC50 = 2 uM) tyrosine kinases.
| Trivial name | ZM 306416 hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A11955-10mM-D |
| Alternative Name(s) | 4-[(4'-Chloro-2'-fluoro)phenylamino]-6,7-dimethoxyquinazoline hydrochloride |
| Molecular Formula | C16H13N3O2FCl.HCl |
| CAS# | 690206-97-4 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=C(C=C(C=C3)Cl)F)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/zm-306416-hydrochloride.html |
