Genipin
API Standard
| Catalog Number | CS-O-30595 |
| Alternative Name(s) | Methyl (1S,2R,6S)-2-hydroxy-9-(hydroxymethyl)-3-oxabcclo[4.3.0]nona-4,8-diene-5carboxylate; Methyl (1S,2R,6S)-2-hydroxy-9-(hydroxymethyl)-3-oxabicyclo[4.3.0]nona-4,8-diene-5-carboxylate |
| Research Area | Genipin is an excellent natural cross-linker for proteins, collagen, gelatin, and chitosan cross-linking. It has a low acute toxicity, with LD50, therefore, much less toxic than glutaraldehyde and many other commonly used synthetic cross-linking reagents. |
| Molecular Formula | C11H14O5 |
| CAS# | 6902-77-8 |
| Purity | >98% |
| SMILES | O=C(C1=CO[C@@H](O)[C@]2([H])C(CO)=CC[C@]12[H])OC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30595.html |